C8H12F2N2O3S — CID 107483090
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 107483090) has the molecular formula C8H12F2N2O3S and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 107483090 |
| Molecular Formula | C8H12F2N2O3S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)N(CCO)CC(F)F)CS1 |
| InChI | InChI=1S/C8H12F2N2O3S/c9-6(10)3-12(1-2-13)7(14)5-4-16-8(15)11-5/h5-6,13H,1-4H2,(H,11,15) |
| InChIKey | BDQJOXLFABBWLM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|