C7H12F3NO3S — CID 107483709
N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-ene-1-sulfonamide (PubChem CID 107483709) has the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-ene-1-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 107483709 |
| Molecular Formula | C7H12F3NO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3S/c1-2-5-15(13,14)11(3-4-12)6-7(8,9)10/h2,12H,1,3-6H2 |
| InChIKey | SEUHTEUXZSQGGN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|