C13H12ClF3N2O — CID 107484431
2-[(7-chloroquinolin-4-yl)-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107484431) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is 2-[(7-chloroquinolin-4-yl)-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[(7-chloroquinolin-4-yl)-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484431 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(7-chloroquinolin-4-yl)-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)(F)F)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H12ClF3N2O/c14-9-1-2-10-11(7-9)18-4-3-12(10)19(5-6-20)8-13(15,16)17/h1-4,7,20H,5-6,8H2 |
| InChIKey | HGWQTVGKMLNUPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |