C14H16F4N2O — CID 107484873
2-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107484873) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484873 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | NCC#Cc1cc(F)cc(CN(CCO)CC(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O/c15-13-7-11(2-1-3-19)6-12(8-13)9-20(4-5-21)10-14(16,17)18/h6-8,21H,3-5,9-10,19H2 |
| InChIKey | HLQGHUOVHQVVGF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|