C11H15F3N4O2 — CID 107485749
2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-N'-pyridin-2-ylacetohydrazide (PubChem CID 107485749) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-N'-pyridin-2-ylacetohydrazide.
| Compound Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-N'-pyridin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 107485749 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-N'-pyridin-2-ylacetohydrazide |
| SMILES | O=C(CN(CCO)CC(F)(F)F)NNc1ccccn1 |
| InChI | InChI=1S/C11H15F3N4O2/c12-11(13,14)8-18(5-6-19)7-10(20)17-16-9-3-1-2-4-15-9/h1-4,19H,5-8H2,(H,15,16)(H,17,20) |
| InChIKey | BYUOLHAGYIXGGF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|