C11H16F2N4O3 — CID 107486352
2-[2,2-difluoroethyl-[(2-hydrazinyl-3-nitrophenyl)methyl]amino]ethanol (PubChem CID 107486352) has the molecular formula C11H16F2N4O3 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[(2-hydrazinyl-3-nitrophenyl)methyl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[(2-hydrazinyl-3-nitrophenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 107486352 |
| Molecular Formula | C11H16F2N4O3 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[2,2-difluoroethyl-[(2-hydrazinyl-3-nitrophenyl)methyl]amino]ethanol |
| SMILES | NNc1c(CN(CCO)CC(F)F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16F2N4O3/c12-10(13)7-16(4-5-18)6-8-2-1-3-9(17(19)20)11(8)15-14/h1-3,10,15,18H,4-7,14H2 |
| InChIKey | URTURYHAUASBQL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|