C11H21F2NO2 — CID 107486395
2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-methylpentanal (PubChem CID 107486395) has the molecular formula C11H21F2NO2 and a molecular weight of 237.29 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-methylpentanal.
| Compound Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-methylpentanal |
|---|---|
| PubChem CID | 107486395 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-2-methylpentanal |
| SMILES | CCCC(C)(C=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H21F2NO2/c1-3-4-11(2,9-16)8-14(5-6-15)7-10(12)13/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | FEUNLADNPIBEQC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|