C11H19F2NO3 — CID 107486398
4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxane-4-carbaldehyde (PubChem CID 107486398) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxane-4-carbaldehyde.
| Compound Name | 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxane-4-carbaldehyde |
|---|---|
| PubChem CID | 107486398 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]oxane-4-carbaldehyde |
| SMILES | O=CC1(CN(CCO)CC(F)F)CCOCC1 |
| InChI | InChI=1S/C11H19F2NO3/c12-10(13)7-14(3-4-15)8-11(9-16)1-5-17-6-2-11/h9-10,15H,1-8H2 |
| InChIKey | KFDXIASILBIDMJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|