C10H16F3NO3 — CID 107486422
3-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]oxolane-3-carbaldehyde (PubChem CID 107486422) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]oxolane-3-carbaldehyde.
| Compound Name | 3-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]oxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 107486422 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]oxolane-3-carbaldehyde |
| SMILES | O=CC1(CN(CCO)CC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C10H16F3NO3/c11-10(12,13)6-14(2-3-15)5-9(7-16)1-4-17-8-9/h7,15H,1-6,8H2 |
| InChIKey | IKALDXWFTHIFQL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|