C12H20N2O3 — CID 107487404
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,4-dioxane-2-carboxamide (PubChem CID 107487404) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 107487404 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCCC1=CCNCC1)C1COCCO1 |
| InChI | InChI=1S/C12H20N2O3/c15-12(11-9-16-7-8-17-11)14-6-3-10-1-4-13-5-2-10/h1,11,13H,2-9H2,(H,14,15) |
| InChIKey | QNGQDICKKPDOAL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|