C13H19F3N2O2 — CID 114489787
2-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 114489787) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 2-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 114489787 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | O=C(COC1CCNCC1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3N2O2/c14-13(15,16)10-3-7-18(8-4-10)12(19)9-20-11-1-5-17-6-2-11/h3,11,17H,1-2,4-9H2 |
| InChIKey | KCGGAGYDAPEKHZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|