C14H21F3N2O2 — CID 114489841
3-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 114489841) has the molecular formula C14H21F3N2O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 3-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 3-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 114489841 |
| Molecular Formula | C14H21F3N2O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-piperidin-4-yloxy-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | O=C(CCOC1CCNCC1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21F3N2O2/c15-14(16,17)11-3-8-19(9-4-11)13(20)5-10-21-12-1-6-18-7-2-12/h3,12,18H,1-2,4-10H2 |
| InChIKey | TZNFLRITTXBANN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|