C12H20F2N2O2 — CID 107486723
3-(2,2-difluoroethoxy)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]propanamide (PubChem CID 107486723) has the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 107486723 |
| Molecular Formula | C12H20F2N2O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]propanamide |
| SMILES | O=C(CCOCC(F)F)NCCC1=CCNCC1 |
| InChI | InChI=1S/C12H20F2N2O2/c13-11(14)9-18-8-4-12(17)16-7-3-10-1-5-15-6-2-10/h1,11,15H,2-9H2,(H,16,17) |
| InChIKey | WQZAQZVJMDRDOZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|