C12H19F3N2O2 — CID 107487341
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 107487341) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 107487341 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NCCC1=CCNCC1 |
| InChI | InChI=1S/C12H19F3N2O2/c13-12(14,15)9-19-8-4-11(18)17-7-3-10-1-5-16-6-2-10/h1,16H,2-9H2,(H,17,18) |
| InChIKey | YURXCNYUOJLOBS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|