C11H20BrF3N2O — CID 107488358
N-(2-bromoethyl)-N-[(4-ethylmorpholin-2-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107488358) has the molecular formula C11H20BrF3N2O and a molecular weight of 333.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4-ethylmorpholin-2-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(4-ethylmorpholin-2-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488358 |
| Molecular Formula | C11H20BrF3N2O |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4-ethylmorpholin-2-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | CCN1CCOC(CN(CCBr)CC(F)(F)F)C1 |
| InChI | InChI=1S/C11H20BrF3N2O/c1-2-16-5-6-18-10(7-16)8-17(4-3-12)9-11(13,14)15/h10H,2-9H2,1H3 |
| InChIKey | JHFGROYVVLFKDB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|