C12H22ClF3N2O — CID 107488854
N-(2-chloroethyl)-2,2,2-trifluoro-N-[(4-propan-2-ylmorpholin-2-yl)methyl]ethanamine (PubChem CID 107488854) has the molecular formula C12H22ClF3N2O and a molecular weight of 302.77 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2,2-trifluoro-N-[(4-propan-2-ylmorpholin-2-yl)methyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(4-propan-2-ylmorpholin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107488854 |
| Molecular Formula | C12H22ClF3N2O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(4-propan-2-ylmorpholin-2-yl)methyl]ethanamine |
| SMILES | CC(C)N1CCOC(CN(CCCl)CC(F)(F)F)C1 |
| InChI | InChI=1S/C12H22ClF3N2O/c1-10(2)18-5-6-19-11(8-18)7-17(4-3-13)9-12(14,15)16/h10-11H,3-9H2,1-2H3 |
| InChIKey | JDDXSAURJJRGDM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|