C14H29ClN2O — CID 114152955
1-chloro-3-methyl-N-[(4-propan-2-ylmorpholin-2-yl)methyl]pentan-3-amine (PubChem CID 114152955) has the molecular formula C14H29ClN2O and a molecular weight of 276.85 g/mol. Its IUPAC name is 1-chloro-3-methyl-N-[(4-propan-2-ylmorpholin-2-yl)methyl]pentan-3-amine.
| Compound Name | 1-chloro-3-methyl-N-[(4-propan-2-ylmorpholin-2-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 114152955 |
| Molecular Formula | C14H29ClN2O |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-chloro-3-methyl-N-[(4-propan-2-ylmorpholin-2-yl)methyl]pentan-3-amine |
| SMILES | CCC(C)(CCCl)NCC1CN(C(C)C)CCO1 |
| InChI | InChI=1S/C14H29ClN2O/c1-5-14(4,6-7-15)16-10-13-11-17(12(2)3)8-9-18-13/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | WZENPUCXCZWEDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|