C14H21N5O — CID 107488769
N-ethyl-6-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridazine-3-carboxamide (PubChem CID 107488769) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N-ethyl-6-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridazine-3-carboxamide.
| Compound Name | N-ethyl-6-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107488769 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-ethyl-6-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]pyridazine-3-carboxamide |
| SMILES | CCNC(=O)c1ccc(NCCC2=CCNCC2)nn1 |
| InChI | InChI=1S/C14H21N5O/c1-2-16-14(20)12-3-4-13(19-18-12)17-10-7-11-5-8-15-9-6-11/h3-5,15H,2,6-10H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | IDZPRVAZRWXLCT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|