C12H19ClF3N — CID 107489188
N-(2-bicyclo[2.2.1]heptanylmethyl)-N-(2-chloroethyl)-2,2,2-trifluoroethanamine (PubChem CID 107489188) has the molecular formula C12H19ClF3N and a molecular weight of 269.74 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-N-(2-chloroethyl)-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-N-(2-chloroethyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107489188 |
| Molecular Formula | C12H19ClF3N |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-N-(2-chloroethyl)-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CN(CCCl)CC1CC2CCC1C2 |
| InChI | InChI=1S/C12H19ClF3N/c13-3-4-17(8-12(14,15)16)7-11-6-9-1-2-10(11)5-9/h9-11H,1-8H2 |
| InChIKey | XIYSLPSYMVLSGN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|