C16H17ClN4 — CID 107490152
6-N-[1-(3-chlorophenyl)ethyl]-6-N-methyl-1H-indazole-5,6-diamine (PubChem CID 107490152) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 6-N-[1-(3-chlorophenyl)ethyl]-6-N-methyl-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[1-(3-chlorophenyl)ethyl]-6-N-methyl-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490152 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6-N-[1-(3-chlorophenyl)ethyl]-6-N-methyl-1H-indazole-5,6-diamine |
| SMILES | CC(c1cccc(Cl)c1)N(C)c1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C16H17ClN4/c1-10(11-4-3-5-13(17)6-11)21(2)16-8-15-12(7-14(16)18)9-19-20-15/h3-10H,18H2,1-2H3,(H,19,20) |
| InChIKey | UJTYJYMBRSCCAL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|