C14H18ClF2NO — CID 107490945
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-(3-methylphenyl)propanamide (PubChem CID 107490945) has the molecular formula C14H18ClF2NO and a molecular weight of 289.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-(3-methylphenyl)propanamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 107490945 |
| Molecular Formula | C14H18ClF2NO |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)N(CCCl)CC(F)F)c1 |
| InChI | InChI=1S/C14H18ClF2NO/c1-11-3-2-4-12(9-11)5-6-14(19)18(8-7-15)10-13(16)17/h2-4,9,13H,5-8,10H2,1H3 |
| InChIKey | BAGUUBJCVJOWFG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|