C10H16ClF2NO2 — CID 107491123
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-methyloxolane-3-carboxamide (PubChem CID 107491123) has the molecular formula C10H16ClF2NO2 and a molecular weight of 255.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-methyloxolane-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 107491123 |
| Molecular Formula | C10H16ClF2NO2 |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-2-methyloxolane-3-carboxamide |
| SMILES | CC1OCCC1C(=O)N(CCCl)CC(F)F |
| InChI | InChI=1S/C10H16ClF2NO2/c1-7-8(2-5-16-7)10(15)14(4-3-11)6-9(12)13/h7-9H,2-6H2,1H3 |
| InChIKey | QYYBFAKZTZBFNU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|