C10H15ClF3NO2 — CID 107492119
N-(2-chloroethyl)-2-methyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide (PubChem CID 107492119) has the molecular formula C10H15ClF3NO2 and a molecular weight of 273.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-2-methyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 107492119 |
| Molecular Formula | C10H15ClF3NO2 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(2-chloroethyl)-2-methyl-N-(2,2,2-trifluoroethyl)oxolane-3-carboxamide |
| SMILES | CC1OCCC1C(=O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C10H15ClF3NO2/c1-7-8(2-5-17-7)9(16)15(4-3-11)6-10(12,13)14/h7-8H,2-6H2,1H3 |
| InChIKey | KHPXNPVDRLVAJU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|