C14H16BrF2NO2 — CID 107491895
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 107491895) has the molecular formula C14H16BrF2NO2 and a molecular weight of 348.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 107491895 |
| Molecular Formula | C14H16BrF2NO2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(C1COc2ccccc2C1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C14H16BrF2NO2/c15-5-6-18(8-13(16)17)14(19)11-7-10-3-1-2-4-12(10)20-9-11/h1-4,11,13H,5-9H2 |
| InChIKey | SSPPTFSANFIZKN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|