C9H14BrF2NO — CID 107491582
N-(2-bromoethyl)-N-(2,2-difluoroethyl)cyclobutanecarboxamide (PubChem CID 107491582) has the molecular formula C9H14BrF2NO and a molecular weight of 270.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)cyclobutanecarboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 107491582 |
| Molecular Formula | C9H14BrF2NO |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)cyclobutanecarboxamide |
| SMILES | O=C(C1CCC1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C9H14BrF2NO/c10-4-5-13(6-8(11)12)9(14)7-2-1-3-7/h7-8H,1-6H2 |
| InChIKey | JRVGCCAXNUFTCB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|