C10H18BrF2NO — CID 107491572
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,2-dimethylbutanamide (PubChem CID 107491572) has the molecular formula C10H18BrF2NO and a molecular weight of 286.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,2-dimethylbutanamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 107491572 |
| Molecular Formula | C10H18BrF2NO |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(CCBr)CC(F)F |
| InChI | InChI=1S/C10H18BrF2NO/c1-4-10(2,3)9(15)14(6-5-11)7-8(12)13/h8H,4-7H2,1-3H3 |
| InChIKey | JFDZYADRSHLLQH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|