C10H13BrF2N2O2 — CID 107491761
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 107491761) has the molecular formula C10H13BrF2N2O2 and a molecular weight of 311.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 107491761 |
| Molecular Formula | C10H13BrF2N2O2 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)N(CCBr)CC(F)F)o1 |
| InChI | InChI=1S/C10H13BrF2N2O2/c1-6-9(17-7(2)14-6)10(16)15(4-3-11)5-8(12)13/h8H,3-5H2,1-2H3 |
| InChIKey | RZTBBTLYVANXIQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|