C11H18BrF2NO2 — CID 107491914
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-(1-methoxycyclobutyl)acetamide (PubChem CID 107491914) has the molecular formula C11H18BrF2NO2 and a molecular weight of 314.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-(1-methoxycyclobutyl)acetamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-(1-methoxycyclobutyl)acetamide |
|---|---|
| PubChem CID | 107491914 |
| Molecular Formula | C11H18BrF2NO2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-(1-methoxycyclobutyl)acetamide |
| SMILES | COC1(CC(=O)N(CCBr)CC(F)F)CCC1 |
| InChI | InChI=1S/C11H18BrF2NO2/c1-17-11(3-2-4-11)7-10(16)15(6-5-12)8-9(13)14/h9H,2-8H2,1H3 |
| InChIKey | XYMIKCFZWQWFGC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|