C15H26F2N2O — CID 107493238
N-(2-aminoethyl)-N-(2,2-difluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide (PubChem CID 107493238) has the molecular formula C15H26F2N2O and a molecular weight of 288.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2,2-difluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107493238 |
| Molecular Formula | C15H26F2N2O |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
| SMILES | NCCN(CC(F)F)C(=O)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C15H26F2N2O/c16-14(17)10-19(8-7-18)15(20)13-6-5-11-3-1-2-4-12(11)9-13/h11-14H,1-10,18H2 |
| InChIKey | IBXHOOHANSWTFF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |