C7H8BrF2N3OS — CID 107491897
N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiadiazole-5-carboxamide (PubChem CID 107491897) has the molecular formula C7H8BrF2N3OS and a molecular weight of 300.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiadiazole-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107491897 |
| Molecular Formula | C7H8BrF2N3OS |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)thiadiazole-5-carboxamide |
| SMILES | O=C(c1cnns1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C7H8BrF2N3OS/c8-1-2-13(4-6(9)10)7(14)5-3-11-12-15-5/h3,6H,1-2,4H2 |
| InChIKey | MSDXBEVFYZWOLL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|