C8H12ClF2N3O2S — CID 107492833
N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-methylimidazole-4-sulfonamide (PubChem CID 107492833) has the molecular formula C8H12ClF2N3O2S and a molecular weight of 287.72 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 107492833 |
| Molecular Formula | C8H12ClF2N3O2S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2-difluoroethyl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)N(CCCl)CC(F)F)c1 |
| InChI | InChI=1S/C8H12ClF2N3O2S/c1-13-5-8(12-6-13)17(15,16)14(3-2-9)4-7(10)11/h5-7H,2-4H2,1H3 |
| InChIKey | WZFSWIPGOMAHCD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|