C11H17F2N3O3 — CID 107493123
5-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 107493123) has the molecular formula C11H17F2N3O3 and a molecular weight of 277.27 g/mol. Its IUPAC name is 5-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 107493123 |
| Molecular Formula | C11H17F2N3O3 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(CN(CCO)CC(F)F)oc1C(=O)NN |
| InChI | InChI=1S/C11H17F2N3O3/c1-7-4-8(19-10(7)11(18)15-14)5-16(2-3-17)6-9(12)13/h4,9,17H,2-3,5-6,14H2,1H3,(H,15,18) |
| InChIKey | HYLGFWUFFGPJHK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|