C12H16F3N3O2 — CID 107493149
2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzohydrazide (PubChem CID 107493149) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzohydrazide.
| Compound Name | 2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzohydrazide |
|---|---|
| PubChem CID | 107493149 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccccc1CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)8-18(5-6-19)7-9-3-1-2-4-10(9)11(20)17-16/h1-4,19H,5-8,16H2,(H,17,20) |
| InChIKey | NMINLCORVSSFTE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|