C7H17F2N3O2S — CID 107493806
1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]propane (PubChem CID 107493806) has the molecular formula C7H17F2N3O2S and a molecular weight of 245.29 g/mol. Its IUPAC name is 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]propane.
| Compound Name | 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]propane |
|---|---|
| PubChem CID | 107493806 |
| Molecular Formula | C7H17F2N3O2S |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-[[2-aminoethyl(2,2-difluoroethyl)sulfamoyl]amino]propane |
| SMILES | CCCNS(=O)(=O)N(CCN)CC(F)F |
| InChI | InChI=1S/C7H17F2N3O2S/c1-2-4-11-15(13,14)12(5-3-10)6-7(8)9/h7,11H,2-6,10H2,1H3 |
| InChIKey | IHOWHADMHWHGFQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |