About 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide
2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 107494621) has the molecular formula C11H23F2N3O
and a molecular weight of 251.32 g/mol. Its IUPAC name is 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide |
| PubChem CID | 107494621 |
| Molecular Formula | C11H23F2N3O |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CN(CCN)CC(F)F |
| InChI | InChI=1S/C11H23F2N3O/c1-4-11(2,3)15-10(17)8-16(6-5-14)7-9(12)13/h9H,4-8,14H2,1-3H3,(H,15,17) |
| InChIKey | NVCZTDICYNOEKN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide?
The IUPAC name of 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide (CID 107494621) is 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide.
What is the SMILES notation for 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide?
The canonical SMILES for 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide is CCC(C)(C)NC(=O)CN(CCN)CC(F)F.
What is the InChIKey of 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide?
The InChIKey is NVCZTDICYNOEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23F2N3O/c1-4-11(2,3)15-10(17)8-16(6-5-14)7-9(12)13/h9H,4-8,14H2,1-3H3,(H,15,17).
What are the key properties of 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide?
2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide has a molecular weight of 251.32 g/mol, XLogP of 0.82, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(2,2-difluoroethyl)amino]-N-(2-methylbutan-2-yl)acetamide is sourced from PubChem (CID 107494621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).