C13H19F2N3O3 — CID 107495088
2-[N-(2,2-difluoroethyl)-3-nitro-5-(propylamino)anilino]ethanol (PubChem CID 107495088) has the molecular formula C13H19F2N3O3 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[N-(2,2-difluoroethyl)-3-nitro-5-(propylamino)anilino]ethanol.
| Compound Name | 2-[N-(2,2-difluoroethyl)-3-nitro-5-(propylamino)anilino]ethanol |
|---|---|
| PubChem CID | 107495088 |
| Molecular Formula | C13H19F2N3O3 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[N-(2,2-difluoroethyl)-3-nitro-5-(propylamino)anilino]ethanol |
| SMILES | CCCNc1cc(N(CCO)CC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19F2N3O3/c1-2-3-16-10-6-11(8-12(7-10)18(20)21)17(4-5-19)9-13(14)15/h6-8,13,16,19H,2-5,9H2,1H3 |
| InChIKey | FEQSBYTYQSFPSD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|