C12H16F2N2O4 — CID 107484162
2-[N-(2,2-difluoroethyl)-3-ethoxy-5-nitroanilino]ethanol (PubChem CID 107484162) has the molecular formula C12H16F2N2O4 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[N-(2,2-difluoroethyl)-3-ethoxy-5-nitroanilino]ethanol.
| Compound Name | 2-[N-(2,2-difluoroethyl)-3-ethoxy-5-nitroanilino]ethanol |
|---|---|
| PubChem CID | 107484162 |
| Molecular Formula | C12H16F2N2O4 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[N-(2,2-difluoroethyl)-3-ethoxy-5-nitroanilino]ethanol |
| SMILES | CCOc1cc(N(CCO)CC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16F2N2O4/c1-2-20-11-6-9(5-10(7-11)16(18)19)15(3-4-17)8-12(13)14/h5-7,12,17H,2-4,8H2,1H3 |
| InChIKey | OSRVQDQHGXUKOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|