C9H10BrF2N3O3 — CID 107484213
2-[(3-bromo-5-nitro-2-pyridinyl)-(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484213) has the molecular formula C9H10BrF2N3O3 and a molecular weight of 326.10 g/mol. Its IUPAC name is 2-[(3-bromo-5-nitro-2-pyridinyl)-(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[(3-bromo-5-nitro-2-pyridinyl)-(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484213 |
| Molecular Formula | C9H10BrF2N3O3 |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-[(3-bromo-5-nitro-2-pyridinyl)-(2,2-difluoroethyl)amino]ethanol |
| SMILES | O=[N+]([O-])c1cnc(N(CCO)CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H10BrF2N3O3/c10-7-3-6(15(17)18)4-13-9(7)14(1-2-16)5-8(11)12/h3-4,8,16H,1-2,5H2 |
| InChIKey | UEPDLMGAOAAKLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|