C11H11BrF2N2O4 — CID 107483128
3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-nitrobenzamide (PubChem CID 107483128) has the molecular formula C11H11BrF2N2O4 and a molecular weight of 353.12 g/mol. Its IUPAC name is 3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-nitrobenzamide.
| Compound Name | 3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 107483128 |
| Molecular Formula | C11H11BrF2N2O4 |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 3-bromo-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-5-nitrobenzamide |
| SMILES | O=C(c1cc(Br)cc([N+](=O)[O-])c1)N(CCO)CC(F)F |
| InChI | InChI=1S/C11H11BrF2N2O4/c12-8-3-7(4-9(5-8)16(19)20)11(18)15(1-2-17)6-10(13)14/h3-5,10,17H,1-2,6H2 |
| InChIKey | HDTRFNRZXWXFBK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|