C13H16F2N2O4 — CID 107483075
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(3-nitrophenyl)propanamide (PubChem CID 107483075) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(3-nitrophenyl)propanamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 107483075 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(3-nitrophenyl)propanamide |
| SMILES | CC(C(=O)N(CCO)CC(F)F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16F2N2O4/c1-9(10-3-2-4-11(7-10)17(20)21)13(19)16(5-6-18)8-12(14)15/h2-4,7,9,12,18H,5-6,8H2,1H3 |
| InChIKey | BXEJPLWJHRPCRC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|