C12H13N3O5 — CID 107495722
1-[2-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethyl]imidazole-4-carboxylic acid (PubChem CID 107495722) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 1-[2-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107495722 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-[2-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCN2C(=O)C3CCC(O3)C2=O)cn1 |
| InChI | InChI=1S/C12H13N3O5/c16-10-8-1-2-9(20-8)11(17)15(10)4-3-14-5-7(12(18)19)13-6-14/h5-6,8-9H,1-4H2,(H,18,19) |
| InChIKey | YAUKZTPIEYKCEG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|