About 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid
1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107497868) has the molecular formula C10H14F3N3O4S
and a molecular weight of 329.30 g/mol. Its IUPAC name is 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
| PubChem CID | 107497868 |
| Molecular Formula | C10H14F3N3O4S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNS(=O)(=O)CCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H14F3N3O4S/c11-10(12,13)2-1-5-21(19,20)15-3-4-16-6-8(9(17)18)14-7-16/h6-7,15H,1-5H2,(H,17,18) |
| InChIKey | XEVRBUXNGVUAHO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid?
The IUPAC name of 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid (CID 107497868) is 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid?
The canonical SMILES for 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid is O=C(O)c1cn(CCNS(=O)(=O)CCCC(F)(F)F)cn1.
What is the InChIKey of 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid?
The InChIKey is XEVRBUXNGVUAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O4S/c11-10(12,13)2-1-5-21(19,20)15-3-4-16-6-8(9(17)18)14-7-16/h6-7,15H,1-5H2,(H,17,18).
What are the key properties of 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid?
1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid has a molecular weight of 329.30 g/mol, XLogP of 0.84, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4,4-trifluorobutylsulfonylamino)ethyl]imidazole-4-carboxylic acid is sourced from PubChem (CID 107497868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).