C13H15N3O4S — CID 107498018
1-[2-[(4-methylphenyl)sulfonylamino]ethyl]imidazole-4-carboxylic acid (PubChem CID 107498018) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107498018 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-[2-[(4-methylphenyl)sulfonylamino]ethyl]imidazole-4-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCn2cnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H15N3O4S/c1-10-2-4-11(5-3-10)21(19,20)15-6-7-16-8-12(13(17)18)14-9-16/h2-5,8-9,15H,6-7H2,1H3,(H,17,18) |
| InChIKey | YJYVQQFOUMKQGI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |