About 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide
1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide (PubChem CID 107498391) has the molecular formula C10H16N6O3
and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide |
| PubChem CID | 107498391 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)N(CC(N)=O)CC(N)=O)c1 |
| InChI | InChI=1S/C10H16N6O3/c11-1-2-15-3-7(14-6-15)10(19)16(4-8(12)17)5-9(13)18/h3,6H,1-2,4-5,11H2,(H2,12,17)(H2,13,18) |
| InChIKey | UOXZRXSUWSXYPF-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide?
The IUPAC name of 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide (CID 107498391) is 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide.
What is the SMILES notation for 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide?
The canonical SMILES for 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide is NCCn1cnc(C(=O)N(CC(N)=O)CC(N)=O)c1.
What is the InChIKey of 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide?
The InChIKey is UOXZRXSUWSXYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O3/c11-1-2-15-3-7(14-6-15)10(19)16(4-8(12)17)5-9(13)18/h3,6H,1-2,4-5,11H2,(H2,12,17)(H2,13,18).
What are the key properties of 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide?
1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide has a molecular weight of 268.28 g/mol, XLogP of -2.75, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-N,N-bis(2-amino-2-oxoethyl)imidazole-4-carboxamide is sourced from PubChem (CID 107498391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).