C10H12N4OS — CID 107499123
1-(2-aminoethyl)-N-thiophen-3-ylimidazole-4-carboxamide (PubChem CID 107499123) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-thiophen-3-ylimidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-thiophen-3-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 107499123 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-(2-aminoethyl)-N-thiophen-3-ylimidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)Nc2ccsc2)c1 |
| InChI | InChI=1S/C10H12N4OS/c11-2-3-14-5-9(12-7-14)10(15)13-8-1-4-16-6-8/h1,4-7H,2-3,11H2,(H,13,15) |
| InChIKey | PKGLIAPTXNNNHB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |