C13H14F2N4OS — CID 107496216
1-(2-aminoethyl)-N-[4-(difluoromethylsulfanyl)phenyl]imidazole-4-carboxamide (PubChem CID 107496216) has the molecular formula C13H14F2N4OS and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[4-(difluoromethylsulfanyl)phenyl]imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[4-(difluoromethylsulfanyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107496216 |
| Molecular Formula | C13H14F2N4OS |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-(2-aminoethyl)-N-[4-(difluoromethylsulfanyl)phenyl]imidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C13H14F2N4OS/c14-13(15)21-10-3-1-9(2-4-10)18-12(20)11-7-19(6-5-16)8-17-11/h1-4,7-8,13H,5-6,16H2,(H,18,20) |
| InChIKey | DLDYEPFGRRHRHK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |