C12H12ClFN4O — CID 107499984
1-(2-aminoethyl)-N-(3-chloro-5-fluorophenyl)imidazole-4-carboxamide (PubChem CID 107499984) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(3-chloro-5-fluorophenyl)imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-(3-chloro-5-fluorophenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107499984 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(2-aminoethyl)-N-(3-chloro-5-fluorophenyl)imidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)Nc2cc(F)cc(Cl)c2)c1 |
| InChI | InChI=1S/C12H12ClFN4O/c13-8-3-9(14)5-10(4-8)17-12(19)11-6-18(2-1-15)7-16-11/h3-7H,1-2,15H2,(H,17,19) |
| InChIKey | ITUNKLTVKQOGSP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |