C10H17N3O3 — CID 107499337
1-methoxypropan-2-yl 1-(2-aminoethyl)imidazole-4-carboxylate (PubChem CID 107499337) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 1-(2-aminoethyl)imidazole-4-carboxylate.
| Compound Name | 1-methoxypropan-2-yl 1-(2-aminoethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 107499337 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-methoxypropan-2-yl 1-(2-aminoethyl)imidazole-4-carboxylate |
| SMILES | COCC(C)OC(=O)c1cn(CCN)cn1 |
| InChI | InChI=1S/C10H17N3O3/c1-8(6-15-2)16-10(14)9-5-13(4-3-11)7-12-9/h5,7-8H,3-4,6,11H2,1-2H3 |
| InChIKey | PEFOXIXQUDCZNZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |