About 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate
2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate (PubChem CID 106202988) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate |
| PubChem CID | 106202988 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate |
| SMILES | NCCn1cnc(C(=O)OCCC2CCC2)c1 |
| InChI | InChI=1S/C12H19N3O2/c13-5-6-15-8-11(14-9-15)12(16)17-7-4-10-2-1-3-10/h8-10H,1-7,13H2 |
| InChIKey | DETXMCHEDMHJOH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate?
The IUPAC name of 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate (CID 106202988) is 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate.
What is the SMILES notation for 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate?
The canonical SMILES for 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate is NCCn1cnc(C(=O)OCCC2CCC2)c1.
What is the InChIKey of 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate?
The InChIKey is DETXMCHEDMHJOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c13-5-6-15-8-11(14-9-15)12(16)17-7-4-10-2-1-3-10/h8-10H,1-7,13H2.
What are the key properties of 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate?
2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate has a molecular weight of 237.30 g/mol, XLogP of 1.19, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 1-(2-aminoethyl)imidazole-4-carboxylate is sourced from PubChem (CID 106202988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).