C13H22N4O3 — CID 107499533
[1-(2-aminoethyl)imidazol-4-yl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone (PubChem CID 107499533) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is [1-(2-aminoethyl)imidazol-4-yl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone.
| Compound Name | [1-(2-aminoethyl)imidazol-4-yl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107499533 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [1-(2-aminoethyl)imidazol-4-yl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone |
| SMILES | NCCn1cnc(C(=O)N2CCC(OCCO)CC2)c1 |
| InChI | InChI=1S/C13H22N4O3/c14-3-6-16-9-12(15-10-16)13(19)17-4-1-11(2-5-17)20-8-7-18/h9-11,18H,1-8,14H2 |
| InChIKey | RNIDMZOBPNTBAE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |